C21H18N6O2 — CID 71180705
2-[(6-ethoxy-2-pyrimidin-5-ylquinazolin-4-yl)amino]benzamide (PubChem CID 71180705) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[(6-ethoxy-2-pyrimidin-5-ylquinazolin-4-yl)amino]benzamide.
| Compound Name | 2-[(6-ethoxy-2-pyrimidin-5-ylquinazolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 71180705 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[(6-ethoxy-2-pyrimidin-5-ylquinazolin-4-yl)amino]benzamide |
| SMILES | CCOc1ccc2nc(-c3cncnc3)nc(Nc3ccccc3C(N)=O)c2c1 |
| InChI | InChI=1S/C21H18N6O2/c1-2-29-14-7-8-18-16(9-14)21(26-17-6-4-3-5-15(17)19(22)28)27-20(25-18)13-10-23-12-24-11-13/h3-12H,2H2,1H3,(H2,22,28)(H,25,26,27) |
| InChIKey | HUQJEAJRFXIXEQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |