C26H24N6O3 — CID 71180546
2-[[6-(2-oxo-2-pyrrolidin-1-ylethoxy)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide (PubChem CID 71180546) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 2-[[6-(2-oxo-2-pyrrolidin-1-ylethoxy)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide.
| Compound Name | 2-[[6-(2-oxo-2-pyrrolidin-1-ylethoxy)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 71180546 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-[[6-(2-oxo-2-pyrrolidin-1-ylethoxy)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1nc(-c2cccnc2)nc2ccc(OCC(=O)N3CCCC3)cc12 |
| InChI | InChI=1S/C26H24N6O3/c27-24(34)19-7-1-2-8-21(19)30-26-20-14-18(35-16-23(33)32-12-3-4-13-32)9-10-22(20)29-25(31-26)17-6-5-11-28-15-17/h1-2,5-11,14-15H,3-4,12-13,16H2,(H2,27,34)(H,29,30,31) |
| InChIKey | CACZPFAZVBNVSN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |