C29H32N6O2 — CID 135127900
2-[4-[2-(1-aminoethyl)anilino]-2-pyridin-3-ylquinazolin-6-yl]oxy-N-cyclohexylacetamide (PubChem CID 135127900) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 2-[4-[2-(1-aminoethyl)anilino]-2-pyridin-3-ylquinazolin-6-yl]oxy-N-cyclohexylacetamide.
| Compound Name | 2-[4-[2-(1-aminoethyl)anilino]-2-pyridin-3-ylquinazolin-6-yl]oxy-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 135127900 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 2-[4-[2-(1-aminoethyl)anilino]-2-pyridin-3-ylquinazolin-6-yl]oxy-N-cyclohexylacetamide |
| SMILES | CC(N)c1ccccc1Nc1nc(-c2cccnc2)nc2ccc(OCC(=O)NC3CCCCC3)cc12 |
| InChI | InChI=1S/C29H32N6O2/c1-19(30)23-11-5-6-12-25(23)34-29-24-16-22(37-18-27(36)32-21-9-3-2-4-10-21)13-14-26(24)33-28(35-29)20-8-7-15-31-17-20/h5-8,11-17,19,21H,2-4,9-10,18,30H2,1H3,(H,32,36)(H,33,34,35) |
| InChIKey | ROHVFOHWJVCSEA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |