C19H13ClN6O — CID 71180723
2-[(7-chloro-2-pyridazin-4-ylquinazolin-4-yl)amino]benzamide (PubChem CID 71180723) has the molecular formula C19H13ClN6O and a molecular weight of 376.81 g/mol. Its IUPAC name is 2-[(7-chloro-2-pyridazin-4-ylquinazolin-4-yl)amino]benzamide.
| Compound Name | 2-[(7-chloro-2-pyridazin-4-ylquinazolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 71180723 |
| Molecular Formula | C19H13ClN6O |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-[(7-chloro-2-pyridazin-4-ylquinazolin-4-yl)amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1nc(-c2ccnnc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H13ClN6O/c20-12-5-6-14-16(9-12)25-18(11-7-8-22-23-10-11)26-19(14)24-15-4-2-1-3-13(15)17(21)27/h1-10H,(H2,21,27)(H,24,25,26) |
| InChIKey | JYZCJQYMPWOHJV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |