C20H17N5O — CID 110431153
2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide (PubChem CID 110431153) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide.
| Compound Name | 2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 110431153 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide |
| SMILES | Cc1cc2c(Nc3ccccc3C(N)=O)nc(-c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C20H17N5O/c1-12-11-15-19(22-12)24-18(13-7-3-2-4-8-13)25-20(15)23-16-10-6-5-9-14(16)17(21)26/h2-11H,1H3,(H2,21,26)(H2,22,23,24,25) |
| InChIKey | CIQBPSMHMVCASH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |