C19H22N4O2 — CID 110431099
2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]hexanoic acid (PubChem CID 110431099) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]hexanoic acid.
| Compound Name | 2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 110431099 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]hexanoic acid |
| SMILES | CCCCC(Nc1nc(-c2ccccc2)nc2[nH]c(C)cc12)C(=O)O |
| InChI | InChI=1S/C19H22N4O2/c1-3-4-10-15(19(24)25)21-18-14-11-12(2)20-17(14)22-16(23-18)13-8-6-5-7-9-13/h5-9,11,15H,3-4,10H2,1-2H3,(H,24,25)(H2,20,21,22,23) |
| InChIKey | HHCPDXKBVWUFFM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |