C18H21ClN4 — CID 110430988
2-(3-chlorophenyl)-6-methyl-N-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 110430988) has the molecular formula C18H21ClN4 and a molecular weight of 328.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-methyl-N-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(3-chlorophenyl)-6-methyl-N-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110430988 |
| Molecular Formula | C18H21ClN4 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(3-chlorophenyl)-6-methyl-N-pentyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCNc1nc(-c2cccc(Cl)c2)nc2[nH]c(C)cc12 |
| InChI | InChI=1S/C18H21ClN4/c1-3-4-5-9-20-17-15-10-12(2)21-18(15)23-16(22-17)13-7-6-8-14(19)11-13/h6-8,10-11H,3-5,9H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | OODVRFNIHCNLJP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|