C14H17N3O3 — CID 122060414
2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid (PubChem CID 122060414) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid.
| Compound Name | 2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122060414 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid |
| SMILES | CCCCC(Nc1noc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-2-3-9-11(13(18)19)15-14-16-12(20-17-14)10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | PZZBVDCFLIPLBJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |