(2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid

C12H21N3O3 — CID 122062788

IUPAC(2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid
SMILESCCCC[C@H](Nc1noc(C(C)(C)C)n1)C(=O)O
InChIInChI=1S/C12H21N3O3/c1-5-6-7-8(9(16)17)13-11-14-10(18-15-11)12(2,3)4/h8H,5-7H2,1-4H3,(H,13,15)(H,16,17)/t8-/m0/s1
InChIKeySSJBDWUKINIEDI-QMMMGPOBSA-N
MW255.32 g/mol
LogP2.42
Rot. Bonds6

About (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid

(2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid (PubChem CID 122062788) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid.

Molecular Properties

Compound Name(2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid
PubChem CID122062788
Molecular FormulaC12H21N3O3
Molecular Weight255.32 g/mol
Exact Mass255.16
IUPAC Name(2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid
SMILESCCCC[C@H](Nc1noc(C(C)(C)C)n1)C(=O)O
InChIInChI=1S/C12H21N3O3/c1-5-6-7-8(9(16)17)13-11-14-10(18-15-11)12(2,3)4/h8H,5-7H2,1-4H3,(H,13,15)(H,16,17)/t8-/m0/s1
InChIKeySSJBDWUKINIEDI-QMMMGPOBSA-N
XLogP2.42
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.32
LogP ≤ 52.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid?
The IUPAC name of (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid (CID 122062788) is (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid.
What is the SMILES notation for (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid?
The canonical SMILES for (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid is CCCC[C@H](Nc1noc(C(C)(C)C)n1)C(=O)O.
What is the InChIKey of (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid?
The InChIKey is SSJBDWUKINIEDI-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-5-6-7-8(9(16)17)13-11-14-10(18-15-11)12(2,3)4/h8H,5-7H2,1-4H3,(H,13,15)(H,16,17)/t8-/m0/s1.
What are the key properties of (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid?
(2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid has a molecular weight of 255.32 g/mol, XLogP of 2.42, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid is sourced from PubChem (CID 122062788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).