C12H21N3O3 — CID 122062788
(2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid (PubChem CID 122062788) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122062788 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2S)-2-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)amino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1noc(C(C)(C)C)n1)C(=O)O |
| InChI | InChI=1S/C12H21N3O3/c1-5-6-7-8(9(16)17)13-11-14-10(18-15-11)12(2,3)4/h8H,5-7H2,1-4H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | SSJBDWUKINIEDI-QMMMGPOBSA-N |
| XLogP | 2.42 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |