C19H25N3O4 — CID 120614642
(2S)-2-[[2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoyl]amino]hexanoic acid (PubChem CID 120614642) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is (2S)-2-[[2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120614642 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (2S)-2-[[2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1ccccc1-c1nc(C(C)(C)C)no1)C(=O)O |
| InChI | InChI=1S/C19H25N3O4/c1-5-6-11-14(17(24)25)20-15(23)12-9-7-8-10-13(12)16-21-18(22-26-16)19(2,3)4/h7-10,14H,5-6,11H2,1-4H3,(H,20,23)(H,24,25)/t14-/m0/s1 |
| InChIKey | PAOYEYUSEODMBL-AWEZNQCLSA-N |
| XLogP | 3.41 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |