C17H24N4O2 — CID 119499680
N-(3-aminobutyl)-2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzamide (PubChem CID 119499680) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-(3-aminobutyl)-2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 119499680 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-(3-aminobutyl)-2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzamide |
| SMILES | CC(N)CCNC(=O)c1ccccc1-c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C17H24N4O2/c1-11(18)9-10-19-14(22)12-7-5-6-8-13(12)15-20-16(21-23-15)17(2,3)4/h5-8,11H,9-10,18H2,1-4H3,(H,19,22) |
| InChIKey | ZMGAXYOUXQECCS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |