C11H16BrN3O3 — CID 122062838
(2S)-2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]hexanoic acid (PubChem CID 122062838) has the molecular formula C11H16BrN3O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122062838 |
| Molecular Formula | C11H16BrN3O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (2S)-2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1ncc(Br)c(OC)n1)C(=O)O |
| InChI | InChI=1S/C11H16BrN3O3/c1-3-4-5-8(10(16)17)14-11-13-6-7(12)9(15-11)18-2/h6,8H,3-5H2,1-2H3,(H,16,17)(H,13,14,15)/t8-/m0/s1 |
| InChIKey | VZLAZHMJRKIWNO-QMMMGPOBSA-N |
| XLogP | 2.30 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |