C14H14BrN3O3 — CID 106997695
methyl 2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-2-phenylacetate (PubChem CID 106997695) has the molecular formula C14H14BrN3O3 and a molecular weight of 352.19 g/mol. Its IUPAC name is methyl 2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-2-phenylacetate.
| Compound Name | methyl 2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 106997695 |
| Molecular Formula | C14H14BrN3O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | methyl 2-[(5-bromo-4-methoxypyrimidin-2-yl)amino]-2-phenylacetate |
| SMILES | COC(=O)C(Nc1ncc(Br)c(OC)n1)c1ccccc1 |
| InChI | InChI=1S/C14H14BrN3O3/c1-20-12-10(15)8-16-14(18-12)17-11(13(19)21-2)9-6-4-3-5-7-9/h3-8,11H,1-2H3,(H,16,17,18) |
| InChIKey | DJWZVYNQSAJEKJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |