C11H23NO3 — CID 103266665
2-[(3-hydroxy-2-methylbutan-2-yl)amino]hexanoic acid (PubChem CID 103266665) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-[(3-hydroxy-2-methylbutan-2-yl)amino]hexanoic acid.
| Compound Name | 2-[(3-hydroxy-2-methylbutan-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 103266665 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 2-[(3-hydroxy-2-methylbutan-2-yl)amino]hexanoic acid |
| SMILES | CCCCC(NC(C)(C)C(C)O)C(=O)O |
| InChI | InChI=1S/C11H23NO3/c1-5-6-7-9(10(14)15)12-11(3,4)8(2)13/h8-9,12-13H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | LVZPJFXJUCOXCX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |