C22H19N5O2 — CID 144501322
2-[(8-methoxy-6-methyl-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide (PubChem CID 144501322) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[(8-methoxy-6-methyl-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide.
| Compound Name | 2-[(8-methoxy-6-methyl-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 144501322 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[(8-methoxy-6-methyl-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide |
| SMILES | COc1cc(C)cc2c(Nc3ccccc3C(N)=O)nc(-c3cccnc3)nc12 |
| InChI | InChI=1S/C22H19N5O2/c1-13-10-16-19(18(11-13)29-2)26-21(14-6-5-9-24-12-14)27-22(16)25-17-8-4-3-7-15(17)20(23)28/h3-12H,1-2H3,(H2,23,28)(H,25,26,27) |
| InChIKey | OWYPDNAVRKDZBM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |