C19H15ClN4O — CID 110431245
4-chloro-2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]phenol (PubChem CID 110431245) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is 4-chloro-2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]phenol.
| Compound Name | 4-chloro-2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 110431245 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-chloro-2-[(6-methyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]phenol |
| SMILES | Cc1cc2c(Nc3cc(Cl)ccc3O)nc(-c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C19H15ClN4O/c1-11-9-14-18(21-11)23-17(12-5-3-2-4-6-12)24-19(14)22-15-10-13(20)7-8-16(15)25/h2-10,25H,1H3,(H2,21,22,23,24) |
| InChIKey | XITJGZWAPYXVSL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|