C16H13ClN4O — CID 162237124
4-chloro-2-[(4-methyl-6-phenyl-1,3,5-triazin-2-yl)amino]phenol (PubChem CID 162237124) has the molecular formula C16H13ClN4O and a molecular weight of 312.76 g/mol. Its IUPAC name is 4-chloro-2-[(4-methyl-6-phenyl-1,3,5-triazin-2-yl)amino]phenol.
| Compound Name | 4-chloro-2-[(4-methyl-6-phenyl-1,3,5-triazin-2-yl)amino]phenol |
|---|---|
| PubChem CID | 162237124 |
| Molecular Formula | C16H13ClN4O |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-chloro-2-[(4-methyl-6-phenyl-1,3,5-triazin-2-yl)amino]phenol |
| SMILES | Cc1nc(Nc2cc(Cl)ccc2O)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13ClN4O/c1-10-18-15(11-5-3-2-4-6-11)21-16(19-10)20-13-9-12(17)7-8-14(13)22/h2-9,22H,1H3,(H,18,19,20,21) |
| InChIKey | ZMTQQPPKYFTTCV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|