C25H23N5O2 — CID 4618882
N-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 4618882) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4618882 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | CN(CCO)c1ccc(C=NNC(=O)c2cc(-c3cccnc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C25H23N5O2/c1-30(13-14-31)20-10-8-18(9-11-20)16-27-29-25(32)22-15-24(19-5-4-12-26-17-19)28-23-7-3-2-6-21(22)23/h2-12,15-17,31H,13-14H2,1H3,(H,29,32) |
| InChIKey | REALABGZVVLSLI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|