C37H29N3O4 — CID 126046638
ethyl 4-[[1-[(Z)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoate (PubChem CID 126046638) has the molecular formula C37H29N3O4 and a molecular weight of 579.66 g/mol. Its IUPAC name is ethyl 4-[[1-[(Z)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoate.
| Compound Name | ethyl 4-[[1-[(Z)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 126046638 |
| Molecular Formula | C37H29N3O4 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | ethyl 4-[[1-[(Z)-[(2-phenylquinoline-4-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(COc2ccc3ccccc3c2/C=N\NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C37H29N3O4/c1-2-43-37(42)28-18-16-25(17-19-28)24-44-35-21-20-26-10-6-7-13-29(26)32(35)23-38-40-36(41)31-22-34(27-11-4-3-5-12-27)39-33-15-9-8-14-30(31)33/h3-23H,2,24H2,1H3,(H,40,41)/b38-23- |
| InChIKey | SPBLXFFXCNOBDU-LRIZEKIPSA-N |
| XLogP | 7.57 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|