C20H24N4O4S — CID 8883829
2-(2-oxo-1-pyridinyl)-N-[(Z)-1-(4-piperidin-1-ylsulfonylphenyl)ethylideneamino]acetamide (PubChem CID 8883829) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-(2-oxo-1-pyridinyl)-N-[(Z)-1-(4-piperidin-1-ylsulfonylphenyl)ethylideneamino]acetamide.
| Compound Name | 2-(2-oxo-1-pyridinyl)-N-[(Z)-1-(4-piperidin-1-ylsulfonylphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 8883829 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-(2-oxo-1-pyridinyl)-N-[(Z)-1-(4-piperidin-1-ylsulfonylphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)Cn1ccccc1=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24N4O4S/c1-16(21-22-19(25)15-23-12-6-3-7-20(23)26)17-8-10-18(11-9-17)29(27,28)24-13-4-2-5-14-24/h3,6-12H,2,4-5,13-15H2,1H3,(H,22,25)/b21-16- |
| InChIKey | FIVTYCGQOLGBOV-PGMHBOJBSA-N |
| XLogP | 1.56 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|