C23H30BrN5O4S — CID 135641646
2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide (PubChem CID 135641646) has the molecular formula C23H30BrN5O4S and a molecular weight of 552.50 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 135641646 |
| Molecular Formula | C23H30BrN5O4S |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]acetamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)CN2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)c(O)c1 |
| InChI | InChI=1S/C23H30BrN5O4S/c1-3-28(4-2)20-8-5-18(22(30)15-20)16-25-26-23(31)17-27-11-13-29(14-12-27)34(32,33)21-9-6-19(24)7-10-21/h5-10,15-16,30H,3-4,11-14,17H2,1-2H3,(H,26,31)/b25-16- |
| InChIKey | VUYZXNFWQKWVNK-XYGWBWBKSA-N |
| XLogP | 2.46 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|