C17H20ClN4O2+ — CID 2262526
N-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide (PubChem CID 2262526) has the molecular formula C17H20ClN4O2+ and a molecular weight of 347.83 g/mol. Its IUPAC name is N-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 2262526 |
| Molecular Formula | C17H20ClN4O2+ |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[(2-chloro-6-methylquinolin-3-yl)methylideneamino]-2-morpholin-4-ium-4-ylacetamide |
| SMILES | Cc1ccc2nc(Cl)c(C=NNC(=O)C[NH+]3CCOCC3)cc2c1 |
| InChI | InChI=1S/C17H19ClN4O2/c1-12-2-3-15-13(8-12)9-14(17(18)20-15)10-19-21-16(23)11-22-4-6-24-7-5-22/h2-3,8-10H,4-7,11H2,1H3,(H,21,23)/p+1 |
| InChIKey | IDOJCCJIVDOEQT-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|