C20H16Cl3N3OS — CID 126123951
N-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 126123951) has the molecular formula C20H16Cl3N3OS and a molecular weight of 452.79 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 126123951 |
| Molecular Formula | C20H16Cl3N3OS |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | N-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | Cc1ccc2cc(/C=N\NC(=O)CSCc3c(Cl)cccc3Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C20H16Cl3N3OS/c1-12-5-6-13-8-14(20(23)25-18(13)7-12)9-24-26-19(27)11-28-10-15-16(21)3-2-4-17(15)22/h2-9H,10-11H2,1H3,(H,26,27)/b24-9- |
| InChIKey | LSGVQGORYUCZHF-OPVMPGTRSA-N |
| XLogP | 5.89 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|