C14H12Cl2N2OS2 — CID 126131430
2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide (PubChem CID 126131430) has the molecular formula C14H12Cl2N2OS2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 126131430 |
| Molecular Formula | C14H12Cl2N2OS2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| SMILES | O=C(CSCc1c(Cl)cccc1Cl)N/N=C\c1cccs1 |
| InChI | InChI=1S/C14H12Cl2N2OS2/c15-12-4-1-5-13(16)11(12)8-20-9-14(19)18-17-7-10-3-2-6-21-10/h1-7H,8-9H2,(H,18,19)/b17-7- |
| InChIKey | JCOMIOYLYKOGMR-IDUWFGFVSA-N |
| XLogP | 4.44 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|