C13H10ClFN2OS — CID 25237585
2-(2-chloro-6-fluorophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]acetamide (PubChem CID 25237585) has the molecular formula C13H10ClFN2OS and a molecular weight of 296.75 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 25237585 |
| Molecular Formula | C13H10ClFN2OS |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)N/N=C/c1cccs1 |
| InChI | InChI=1S/C13H10ClFN2OS/c14-11-4-1-5-12(15)10(11)7-13(18)17-16-8-9-3-2-6-19-9/h1-6,8H,7H2,(H,17,18)/b16-8+ |
| InChIKey | MNUFHOQBBCGCAH-LZYBPNLTSA-N |
| XLogP | 3.23 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|