C15H13Cl2N3O2S — CID 6875689
N-(2,4-dichlorophenyl)-N'-[(E)-thiophen-2-ylmethylideneamino]butanediamide (PubChem CID 6875689) has the molecular formula C15H13Cl2N3O2S and a molecular weight of 370.26 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N'-[(E)-thiophen-2-ylmethylideneamino]butanediamide.
| Compound Name | N-(2,4-dichlorophenyl)-N'-[(E)-thiophen-2-ylmethylideneamino]butanediamide |
|---|---|
| PubChem CID | 6875689 |
| Molecular Formula | C15H13Cl2N3O2S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N'-[(E)-thiophen-2-ylmethylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Cl)cc1Cl)N/N=C/c1cccs1 |
| InChI | InChI=1S/C15H13Cl2N3O2S/c16-10-3-4-13(12(17)8-10)19-14(21)5-6-15(22)20-18-9-11-2-1-7-23-11/h1-4,7-9H,5-6H2,(H,19,21)(H,20,22)/b18-9+ |
| InChIKey | QUXNFMZQFKFLHP-GIJQJNRQSA-N |
| XLogP | 3.92 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|