C19H18Cl2N2O4S — CID 126127575
methyl 2-[4-[(Z)-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126127575) has the molecular formula C19H18Cl2N2O4S and a molecular weight of 441.34 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126127575 |
| Molecular Formula | C19H18Cl2N2O4S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | methyl 2-[4-[(Z)-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N\NC(=O)CSCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O4S/c1-26-19(25)10-27-14-7-5-13(6-8-14)9-22-23-18(24)12-28-11-15-16(20)3-2-4-17(15)21/h2-9H,10-12H2,1H3,(H,23,24)/b22-9- |
| InChIKey | XQXXNJWKBPCHDM-AFPJDJCSSA-N |
| XLogP | 3.93 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|