C21H20ClN3O4 — CID 3624333
N-[(2-chloro-7-methylquinolin-3-yl)methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 3624333) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is N-[(2-chloro-7-methylquinolin-3-yl)methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2-chloro-7-methylquinolin-3-yl)methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3624333 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[(2-chloro-7-methylquinolin-3-yl)methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NN=Cc2cc3ccc(C)cc3nc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C21H20ClN3O4/c1-12-5-6-13-8-15(20(22)24-16(13)7-12)11-23-25-21(26)14-9-17(27-2)19(29-4)18(10-14)28-3/h5-11H,1-4H3,(H,25,26) |
| InChIKey | ZKSJXQKWULXXRI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|