C16H18Cl2N4O — CID 44660832
(2S)-N-[(E)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]pyrrolidin-1-ium-2-carboxamide chloride (PubChem CID 44660832) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is (2S)-N-[(E)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]pyrrolidin-1-ium-2-carboxamide chloride.
| Compound Name | (2S)-N-[(E)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]pyrrolidin-1-ium-2-carboxamide chloride |
|---|---|
| PubChem CID | 44660832 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2S)-N-[(E)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]pyrrolidin-1-ium-2-carboxamide chloride |
| SMILES | Cc1ccc2cc(/C=N/NC(=O)[C@@H]3CCC[NH2+]3)c(Cl)nc2c1.[Cl-] |
| InChI | InChI=1S/C16H17ClN4O.ClH/c1-10-4-5-11-8-12(15(17)20-14(11)7-10)9-19-21-16(22)13-3-2-6-18-13;/h4-5,7-9,13,18H,2-3,6H2,1H3,(H,21,22);1H/b19-9+;/t13-;/m0./s1 |
| InChIKey | SOPYLZYPMGXXGA-CNUKQECISA-N |
| XLogP | -1.62 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|