C16H20Cl2N4O — CID 44664586
[(2R)-1-[(2E)-2-[(2-chloro-7-methylquinolin-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride (PubChem CID 44664586) has the molecular formula C16H20Cl2N4O and a molecular weight of 355.27 g/mol. Its IUPAC name is [(2R)-1-[(2E)-2-[(2-chloro-7-methylquinolin-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride.
| Compound Name | [(2R)-1-[(2E)-2-[(2-chloro-7-methylquinolin-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 44664586 |
| Molecular Formula | C16H20Cl2N4O |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [(2R)-1-[(2E)-2-[(2-chloro-7-methylquinolin-3-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride |
| SMILES | Cc1ccc2cc(/C=N/NC(=O)[C@H]([NH3+])C(C)C)c(Cl)nc2c1.[Cl-] |
| InChI | InChI=1S/C16H19ClN4O.ClH/c1-9(2)14(18)16(22)21-19-8-12-7-11-5-4-10(3)6-13(11)20-15(12)17;/h4-9,14H,18H2,1-3H3,(H,21,22);1H/b19-8+;/t14-;/m1./s1 |
| InChIKey | CTBMNCFZNPEQCL-HAOMSIHASA-N |
| XLogP | -1.08 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|