C23H18BrClN2O4S — CID 126222112
4-[[2-bromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126222112) has the molecular formula C23H18BrClN2O4S and a molecular weight of 533.83 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126222112 |
| Molecular Formula | C23H18BrClN2O4S |
| Molecular Weight | 533.83 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | 4-[[2-bromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(CSc1ccc(Cl)cc1)N/N=C\c1ccc(OCc2ccc(C(=O)O)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H18BrClN2O4S/c24-20-11-16(12-26-27-22(28)14-32-19-8-6-18(25)7-9-19)3-10-21(20)31-13-15-1-4-17(5-2-15)23(29)30/h1-12H,13-14H2,(H,27,28)(H,29,30)/b26-12- |
| InChIKey | CCCSKPJKNHQWKP-ZRGSRPPYSA-N |
| XLogP | 5.62 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|