C26H27ClN2O3S — CID 126136682
N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(4-methylphenyl)sulfanylpropanamide (PubChem CID 126136682) has the molecular formula C26H27ClN2O3S and a molecular weight of 483.03 g/mol. Its IUPAC name is N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126136682 |
| Molecular Formula | C26H27ClN2O3S |
| Molecular Weight | 483.03 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(4-methylphenyl)sulfanylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CCSc2ccc(C)cc2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H27ClN2O3S/c1-3-31-25-16-20(9-12-24(25)32-18-21-5-4-6-22(27)15-21)17-28-29-26(30)13-14-33-23-10-7-19(2)8-11-23/h4-12,15-17H,3,13-14,18H2,1-2H3,(H,29,30)/b28-17- |
| InChIKey | HGUAMEVQLLOXRH-QRQIAZFYSA-N |
| XLogP | 6.26 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.03 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|