C31H29ClN2O3S — CID 124544518
4-(benzylsulfanylmethyl)-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzamide (PubChem CID 124544518) has the molecular formula C31H29ClN2O3S and a molecular weight of 545.10 g/mol. Its IUPAC name is 4-(benzylsulfanylmethyl)-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-(benzylsulfanylmethyl)-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124544518 |
| Molecular Formula | C31H29ClN2O3S |
| Molecular Weight | 545.10 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 4-(benzylsulfanylmethyl)-N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(CSCc3ccccc3)cc2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C31H29ClN2O3S/c1-2-36-30-18-25(13-16-29(30)37-20-26-9-6-10-28(32)17-26)19-33-34-31(35)27-14-11-24(12-15-27)22-38-21-23-7-4-3-5-8-23/h3-19H,2,20-22H2,1H3,(H,34,35)/b33-19- |
| InChIKey | OLZUERNGNQCOQN-APTWKGOFSA-N |
| XLogP | 7.51 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.10 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|