C23H24O5S — CID 54532989
[3-(3-hydroxypropyl)-4-phenylmethoxyphenyl] 3-methylbenzenesulfonate (PubChem CID 54532989) has the molecular formula C23H24O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is [3-(3-hydroxypropyl)-4-phenylmethoxyphenyl] 3-methylbenzenesulfonate.
| Compound Name | [3-(3-hydroxypropyl)-4-phenylmethoxyphenyl] 3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54532989 |
| Molecular Formula | C23H24O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [3-(3-hydroxypropyl)-4-phenylmethoxyphenyl] 3-methylbenzenesulfonate |
| SMILES | Cc1cccc(S(=O)(=O)Oc2ccc(OCc3ccccc3)c(CCCO)c2)c1 |
| InChI | InChI=1S/C23H24O5S/c1-18-7-5-11-22(15-18)29(25,26)28-21-12-13-23(20(16-21)10-6-14-24)27-17-19-8-3-2-4-9-19/h2-5,7-9,11-13,15-16,24H,6,10,14,17H2,1H3 |
| InChIKey | YXVGPWAGPVAECB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|