C28H44O3 — CID 170716908
1-butyl-2-[(3-methylphenyl)methoxy]benzene;(2S)-2-ethylpentanoic acid;propane (PubChem CID 170716908) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is 1-butyl-2-[(3-methylphenyl)methoxy]benzene;(2S)-2-ethylpentanoic acid;propane.
| Compound Name | 1-butyl-2-[(3-methylphenyl)methoxy]benzene;(2S)-2-ethylpentanoic acid;propane |
|---|---|
| PubChem CID | 170716908 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 1-butyl-2-[(3-methylphenyl)methoxy]benzene;(2S)-2-ethylpentanoic acid;propane |
| SMILES | CCC.CCCC(CC)C(=O)O.CCCCc1ccccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C18H22O.C7H14O2.C3H8/c1-3-4-10-17-11-5-6-12-18(17)19-14-16-9-7-8-15(2)13-16;1-3-5-6(4-2)7(8)9;1-3-2/h5-9,11-13H,3-4,10,14H2,1-2H3;6H,3-5H2,1-2H3,(H,8,9);3H2,1-2H3 |
| InChIKey | QXTOOVFEQKLADH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |