C29H46O2 — CID 170716937
1-butyl-2-[2-(3-methylphenyl)ethyl]benzene;2-ethylpentanoic acid;propane (PubChem CID 170716937) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 1-butyl-2-[2-(3-methylphenyl)ethyl]benzene;2-ethylpentanoic acid;propane.
| Compound Name | 1-butyl-2-[2-(3-methylphenyl)ethyl]benzene;2-ethylpentanoic acid;propane |
|---|---|
| PubChem CID | 170716937 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 1-butyl-2-[2-(3-methylphenyl)ethyl]benzene;2-ethylpentanoic acid;propane |
| SMILES | CCC.CCCC(CC)C(=O)O.CCCCc1ccccc1CCc1cccc(C)c1 |
| InChI | InChI=1S/C19H24.C7H14O2.C3H8/c1-3-4-10-18-11-5-6-12-19(18)14-13-17-9-7-8-16(2)15-17;1-3-5-6(4-2)7(8)9;1-3-2/h5-9,11-12,15H,3-4,10,13-14H2,1-2H3;6H,3-5H2,1-2H3,(H,8,9);3H2,1-2H3 |
| InChIKey | BPVZOWCBCJSEIZ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |