C14H20O3S — CID 113373680
2-[(3-methylphenyl)methylsulfinyl]hexanoic acid (PubChem CID 113373680) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methylsulfinyl]hexanoic acid.
| Compound Name | 2-[(3-methylphenyl)methylsulfinyl]hexanoic acid |
|---|---|
| PubChem CID | 113373680 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[(3-methylphenyl)methylsulfinyl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)S(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C14H20O3S/c1-3-4-8-13(14(15)16)18(17)10-12-7-5-6-11(2)9-12/h5-7,9,13H,3-4,8,10H2,1-2H3,(H,15,16) |
| InChIKey | UPEVMASFNVSOQI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |