C14H21NO2S — CID 95329730
(2R)-2-[(R)-(3-methylphenyl)methylsulfinyl]-N-propylpropanamide (PubChem CID 95329730) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is (2R)-2-[(R)-(3-methylphenyl)methylsulfinyl]-N-propylpropanamide.
| Compound Name | (2R)-2-[(R)-(3-methylphenyl)methylsulfinyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 95329730 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2R)-2-[(R)-(3-methylphenyl)methylsulfinyl]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@@H](C)[S@](=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-4-8-15-14(16)12(3)18(17)10-13-7-5-6-11(2)9-13/h5-7,9,12H,4,8,10H2,1-3H3,(H,15,16)/t12-,18-/m1/s1 |
| InChIKey | YCDZZLVXTPJZIP-KZULUSFZSA-N |
| XLogP | 2.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |