C13H18O3S — CID 79414784
2-methyl-3-[(3-methylphenyl)methylsulfinyl]butanoic acid (PubChem CID 79414784) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-methyl-3-[(3-methylphenyl)methylsulfinyl]butanoic acid.
| Compound Name | 2-methyl-3-[(3-methylphenyl)methylsulfinyl]butanoic acid |
|---|---|
| PubChem CID | 79414784 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-methyl-3-[(3-methylphenyl)methylsulfinyl]butanoic acid |
| SMILES | Cc1cccc(CS(=O)C(C)C(C)C(=O)O)c1 |
| InChI | InChI=1S/C13H18O3S/c1-9-5-4-6-12(7-9)8-17(16)11(3)10(2)13(14)15/h4-7,10-11H,8H2,1-3H3,(H,14,15) |
| InChIKey | ALUVTGDBEVJLHA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |