C26H26N2O3 — CID 51990543
(2R)-3-(1H-indol-3-yl)-2-[[2-[(3-methylphenyl)methoxy]phenyl]methylamino]propanoic acid (PubChem CID 51990543) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2R)-3-(1H-indol-3-yl)-2-[[2-[(3-methylphenyl)methoxy]phenyl]methylamino]propanoic acid.
| Compound Name | (2R)-3-(1H-indol-3-yl)-2-[[2-[(3-methylphenyl)methoxy]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 51990543 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2R)-3-(1H-indol-3-yl)-2-[[2-[(3-methylphenyl)methoxy]phenyl]methylamino]propanoic acid |
| SMILES | Cc1cccc(COc2ccccc2CN[C@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 |
| InChI | InChI=1S/C26H26N2O3/c1-18-7-6-8-19(13-18)17-31-25-12-5-2-9-20(25)15-28-24(26(29)30)14-21-16-27-23-11-4-3-10-22(21)23/h2-13,16,24,27-28H,14-15,17H2,1H3,(H,29,30)/t24-/m1/s1 |
| InChIKey | WOMRZJYPTCYSRZ-XMMPIXPASA-N |
| XLogP | 4.84 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |