C27H28N2O4 — CID 51987884
(2S)-2-[(3-ethoxy-2-phenylmethoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 51987884) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2S)-2-[(3-ethoxy-2-phenylmethoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[(3-ethoxy-2-phenylmethoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 51987884 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (2S)-2-[(3-ethoxy-2-phenylmethoxyphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCOc1cccc(CN[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c1-2-32-25-14-8-11-20(26(25)33-18-19-9-4-3-5-10-19)16-29-24(27(30)31)15-21-17-28-23-13-7-6-12-22(21)23/h3-14,17,24,28-29H,2,15-16,18H2,1H3,(H,30,31)/t24-/m0/s1 |
| InChIKey | WNCITIBQGKBMDY-DEOSSOPVSA-N |
| XLogP | 4.93 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |