C30H47N5O3 — CID 14608133
N-[(2S)-1-[3-[3-(4-aminobutylamino)propylamino]propylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]butanamide (PubChem CID 14608133) has the molecular formula C30H47N5O3 and a molecular weight of 525.74 g/mol. Its IUPAC name is N-[(2S)-1-[3-[3-(4-aminobutylamino)propylamino]propylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]butanamide.
| Compound Name | N-[(2S)-1-[3-[3-(4-aminobutylamino)propylamino]propylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 14608133 |
| Molecular Formula | C30H47N5O3 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.37 |
| IUPAC Name | N-[(2S)-1-[3-[3-(4-aminobutylamino)propylamino]propylamino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]butanamide |
| SMILES | CCCC(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)NCCCNCCCNCCCCN |
| InChI | InChI=1S/C30H47N5O3/c1-2-10-29(36)35-28(30(37)34-22-9-21-33-20-8-19-32-18-7-6-17-31)23-25-13-15-27(16-14-25)38-24-26-11-4-3-5-12-26/h3-5,11-16,28,32-33H,2,6-10,17-24,31H2,1H3,(H,34,37)(H,35,36)/t28-/m0/s1 |
| InChIKey | FRUMVTGHXCDFCQ-NDEPHWFRSA-N |
| XLogP | 2.91 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|