C14H14NO5- — CID 71407706
(2S)-4-methoxy-4-oxo-2-(3-phenylprop-2-enoylamino)butanoate (PubChem CID 71407706) has the molecular formula C14H14NO5- and a molecular weight of 276.27 g/mol. Its IUPAC name is (2S)-4-methoxy-4-oxo-2-(3-phenylprop-2-enoylamino)butanoate.
| Compound Name | (2S)-4-methoxy-4-oxo-2-(3-phenylprop-2-enoylamino)butanoate |
|---|---|
| PubChem CID | 71407706 |
| Molecular Formula | C14H14NO5- |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (2S)-4-methoxy-4-oxo-2-(3-phenylprop-2-enoylamino)butanoate |
| SMILES | COC(=O)C[C@H](NC(=O)C=Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C14H15NO5/c1-20-13(17)9-11(14(18)19)15-12(16)8-7-10-5-3-2-4-6-10/h2-8,11H,9H2,1H3,(H,15,16)(H,18,19)/p-1/t11-/m0/s1 |
| InChIKey | JNQTVRZYSJRWMU-NSHDSACASA-M |
| XLogP | -0.50 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|