C13H15Cl2NO5 — CID 61242581
2-[3-(3,4-dichlorophenoxy)propanoylamino]-4-hydroxybutanoic acid (PubChem CID 61242581) has the molecular formula C13H15Cl2NO5 and a molecular weight of 336.17 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenoxy)propanoylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[3-(3,4-dichlorophenoxy)propanoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61242581 |
| Molecular Formula | C13H15Cl2NO5 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-[3-(3,4-dichlorophenoxy)propanoylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(CCOc1ccc(Cl)c(Cl)c1)NC(CCO)C(=O)O |
| InChI | InChI=1S/C13H15Cl2NO5/c14-9-2-1-8(7-10(9)15)21-6-4-12(18)16-11(3-5-17)13(19)20/h1-2,7,11,17H,3-6H2,(H,16,18)(H,19,20) |
| InChIKey | RCOXQQGTZDWMOT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |