C13H15Cl2NO5 — CID 81084815
2-[3-(3,4-dichlorophenoxy)propanoylamino]-3-methoxypropanoic acid (PubChem CID 81084815) has the molecular formula C13H15Cl2NO5 and a molecular weight of 336.17 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenoxy)propanoylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[3-(3,4-dichlorophenoxy)propanoylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81084815 |
| Molecular Formula | C13H15Cl2NO5 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-[3-(3,4-dichlorophenoxy)propanoylamino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)CCOc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H15Cl2NO5/c1-20-7-11(13(18)19)16-12(17)4-5-21-8-2-3-9(14)10(15)6-8/h2-3,6,11H,4-5,7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | GISZFMDQFAOGLW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |