C12H14N4O4 — CID 106166308
N-(3-amino-2-hydroxy-3-oxopropyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 106166308) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 106166308 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C12H14N4O4/c13-11(18)9(17)6-14-12(19)10-3-2-8(20-10)7-16-5-1-4-15-16/h1-5,9,17H,6-7H2,(H2,13,18)(H,14,19) |
| InChIKey | UMKFTDGZODOVIZ-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |