C17H16N4O3 — CID 95593404
N-[(1S)-2-amino-2-oxo-1-phenylethyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 95593404) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-[(1S)-2-amino-2-oxo-1-phenylethyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[(1S)-2-amino-2-oxo-1-phenylethyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 95593404 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(1S)-2-amino-2-oxo-1-phenylethyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | NC(=O)[C@@H](NC(=O)c1ccc(Cn2cccn2)o1)c1ccccc1 |
| InChI | InChI=1S/C17H16N4O3/c18-16(22)15(12-5-2-1-3-6-12)20-17(23)14-8-7-13(24-14)11-21-10-4-9-19-21/h1-10,15H,11H2,(H2,18,22)(H,20,23)/t15-/m0/s1 |
| InChIKey | PFJVVWTZMLQMLJ-HNNXBMFYSA-N |
| XLogP | 1.48 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |