C12H13N3O5 — CID 43357614
3-hydroxy-2-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]propanoic acid (PubChem CID 43357614) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 3-hydroxy-2-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43357614 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-hydroxy-2-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(NC(CO)C(=O)O)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C12H13N3O5/c16-7-9(12(18)19)14-11(17)10-3-2-8(20-10)6-15-5-1-4-13-15/h1-5,9,16H,6-7H2,(H,14,17)(H,18,19) |
| InChIKey | PDYVFKZUIGIASM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |