C16H17N3O4 — CID 95740980
N-[(3S)-3-(furan-2-yl)-3-hydroxypropyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 95740980) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[(3S)-3-(furan-2-yl)-3-hydroxypropyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[(3S)-3-(furan-2-yl)-3-hydroxypropyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 95740980 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[(3S)-3-(furan-2-yl)-3-hydroxypropyl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(NCC[C@H](O)c1ccco1)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C16H17N3O4/c20-13(14-3-1-10-22-14)6-8-17-16(21)15-5-4-12(23-15)11-19-9-2-7-18-19/h1-5,7,9-10,13,20H,6,8,11H2,(H,17,21)/t13-/m0/s1 |
| InChIKey | AFVDQGAPHSNNFU-ZDUSSCGKSA-N |
| XLogP | 1.97 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |