C16H17BrN2O5 — CID 108539867
5-bromo-N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]furan-2-carboxamide (PubChem CID 108539867) has the molecular formula C16H17BrN2O5 and a molecular weight of 397.23 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 108539867 |
| Molecular Formula | C16H17BrN2O5 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 5-bromo-N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]furan-2-carboxamide |
| SMILES | CC(Oc1ccc(O)cc1)C(=O)NCCNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H17BrN2O5/c1-10(23-12-4-2-11(20)3-5-12)15(21)18-8-9-19-16(22)13-6-7-14(17)24-13/h2-7,10,20H,8-9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | IMMVMAUHNZGEDY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|